Why does carbon bond covalently, rather than ionically?
Define catenation.
The covalent bonding of atoms of the same element into a series (chain/ring).
What are functional groups?
Modifiers responsible for the reactionary properties of molecules.
What are:
Give the molecular formula of benzene.
C6H6
What is a homologous series?
A family of hydrocarbons which share the same general formula.
Same functional groups; Un differs from Un+1 by -CH2
What is the general formula of an alkyl group?
CnH2n + 1
The common name for a compound is PVC, but its ___ name is polychloroethene.
systematic
Give the shortened structural formula of ethane.
CH3-CH3
CH3CH3
Give the electronic configuration of:
1s22s22p2 → 1s22s12p3

What is the general formula of cycloalkanes?
CnH2n
Define:
Name C2H5CH2(CH2)CH2(C2H5)C2H5
3-ethyl-4-methyl-hexane
Keep numbers as low as possible but also list side chains alphabetically.
Name CH2-C-CH-C2H5
Penta-1,2-diene
Don’t forget the a
Define cracking.
A reaction in which a larger molecule is turned into smaller ones.
What is homogeneous catalysis?
Catalysis in which the reactants and catalyst are in the same physical state.
What is heterogeneous catalysis?
Catalysis in which the reactants and catalyst are in different physical states.
Usually involves gases and/or liquids reacting in presence of solid catalyst
Describe the process of heterogeneous catalysis, where the catalyst is a solid surface.
What is a catalyst poison?
A substance that stops a catalyst functioning properly.