Defintions Flashcards Preview

Chemistry 14B > Defintions > Flashcards

Flashcards in Defintions Deck (10)
Loading flashcards...
1

is the difference in free energy between the starting material and its transition state

activation energy

2

is the heat of reaction or a measure of the bond energy changes in a reaction

enthalpy

3

is how the rate will change as a function of reactant concentration

rate constant

4

if the mechanism of the forward reaction is known, then the mechanism for the reverse action is known

microscopic reversibility

5

slow step of the reaction

rate determining step

6

is the process that can be reversed by an infinitesimal change in variable

reversible process

7

a reaction, in which the product distribution is determined by the heights of the different transition states leading to products

kinetic control

8

describes the probability that a system will be in a particular state

entropy

9

is the electrode at which oxidation takes place

anode

10

CH3(CH2CH2)C2(CH2)CH2OCH2CH2CH3

ETHER