Module 3 Flashcards
(102 cards)
Organic chemistry is the study of which element?
Carbon
The molecular formula for glucose fructose and galactose is C6H12O6. Because they all have different molecular structures, they are?
Isomers
Carbon is unique because it can form a wide variety of compounds. The reason for this is because carbon is in a group IV of the periodic table and therefore can form___ bonds.
4
What is the name of the functional group shown here? R–O-H?
Hydroxyl
What is the name of the functional group shown here? R–S-H?
Sulfahydrl
What is the name of the functional group with this formula -PO42-?
Phosphate (important for ATP)
An organic molecule with a carbon/water ratio of 1:1 is a?
Carbohydrate
Which of the macronutrients is water insoluble because it has more carbon than oxygen atoms?
Lipids
Multiple amino acids connected with peptide bonds are called a?
Polypeptide (up to 30 then it is called a protein)
The building blocks of polymers are?
Monomers
What are the monomers of polysaccharides?
Monosaccharides
What would be the molecular formula of a monosaccharide containing 5 carbons?
C5H10O5 Pentose sugars
To be considered a triglyceride, there must be a glycerol backbone and three?
Fatty acids
A macronutrient monomer with the molecular formula of CH3(CH2)4CH=CH-CH2-CH=CH-(CH2)7COOH is likely a?
Lipid (unsatured fat)
A macronutrient with an amino, carboxyl, and “R” group is called a?
Amino acid
Polymers of amino acids are?
Proteins (above 30) below 30 Polypeptide
Because they are monosaccharides containing 5 carbons, ribose and deoxyribose are?
Pentoses (pentose sugars)
A polymer of nucleotides is a?
DNA and RNA
A compound that contains three or more monosaccharides is a?
Polysaccharides
Stored polysaccharide in plants that is digestible by humans is?
Starch (amylome)
What is the name of the anabolic reaction that connects nutrient monomers to form polymers?
Dehydration synthesis (endogonic reaction) receive energy
ABO blood groups are characterized by different____ on the cell’s surface?
Glycolipid
Cellulose is found in plant cell walls, but cannot be ___ by humans.
digested
Two amino acids that have been combined by a dehydration synthesis reaction is called a?
dipeptide