problem set 7 Flashcards Preview

Biochem > problem set 7 > Flashcards

Flashcards in problem set 7 Deck (80)
1

compounds which have a glycerol backbone

1. phospholipids
2. fats
3. glycolipids

2

compounds with NO glycerol backbone

1. fatty acids
2. sphingolipids
3. steroids
4. waxes

3

WATER SOLUBLE

1. galactose
2. triose
3. a salt of a fatty acid
4. soap

4

NOT water soluble

1. oils
2. steroids
3. fats
4. wax
5. cellulose

5

CO2

slide

6

steroid hormone

slide

7

fatty acid

slide

8

amino acid

protein channels

9

cholesterol

slide

10

glucose

protein channel

11

starch

cannot enter

12

lactose

cannot enter

13

diethylether

soluble

14

ribose

protein channel

15

ethanol

protein channel

16

glycerol

protein channel

17

a protein hormone

cannot enter

18

Saponifiable compounds

1. wax
2. triglyceride
3. phosphoglyceride
4. glycolipid
5. oil

19

NON saponifiable

a. steroids
b. fatty acid
c. prostaglandin

20

contains hydrophilic end

1. phospholipids
2. cephalin
3. lecithin
4. soap

21

NO hydrophilic end

a. steroid
b. triglycerides
c. fats
d. oils
e. waxes

22

Most polar
a. triglyceride
b. waxes
c. oils
d. fats
e. phospholipids

phospholipids

23

lowest melting point
CH3(CH2)10COOH
CH3(CH2)12COOH
CH3(CH2)6COOH

CH3(CH2)12COOH

most carbons

24

good cholesterol

HDL

25

transports most of the cholesterol to the cells

LDL

26

carries triglycerides from the intestine to the fat cells

VLDL

27

has the greatest abundance of protein

HDL

28

transports cholesterol to the liver

HDL

29

the least dense of the three of proteins

HDL

30

carries triglycerides synthesized in the liver to the muscles

VLDL

31

bad cholesterol

LDL

32

which contains phospholipids and proteins

VLDL
HDL
LDL

33

components of
cholesterol

steroid structure

34

components of
arachidonic acid

fatty acid

35

components of
choline

amine alcohol

36

components of
aldosterone

steroid structure

37

components of
olestra

sucrose
fatty acid

38

components of
estrogen

steroid structure

39

components of
glycolipid

galactose

glycerol

40

components of
beeswax

fatty acid

long chain alcohol

41

components of
olive oil

glycerol

fatty acid

42

components of
glycogen

glucose

43

components of
lecithin

glycerol
fatty acid

phosphate
amine alcohol

44

components of
butter

glycerol

fatty acid

45

components of
vitamin D

steroid structure

46

components of
cephalin

glycerol

fatty acid
phosphate

amine alcohol

47

progesterone

steroid structure

48

dextrin

glucose

49

lecithin

3chains
double bond, amine

glycerol
fatty acid

phosphate
amine alcohol

50

wax

CH3(CH2)28CH2-O-C(CH2)14CH3

fatty acid

long chain alcohol

51

fat

glycerol
fatty acid

52

cell membrane

phospholipids

53

enzyme 1 causes compound B to be released
name enzyme

phospholipase

54

compound B
coming from phospholipase

arachidonic acid

55

what kind of compound is aracidonic acid

fatty acid

56

enzyme 2 is used to convert B to C what is the name of enzyme 2

cyclooxygenase

57

what types of compounds are D E F

prostaglandins

58

what prescription anti-inflammatory inhibits enzyme 1
(phospholipase)

cortisone

59

what over the counter inhibits enzyme 2
(cyclooxygenase)

aspirin

60

what prescription drug is used to inhibit one form of the enzyme and not the other

celebrex

VIOXX

61

what compound is used to synthesize cholesterol

acetyl CoA

62

where is cholesterol made

liver

63

where is excess cholesterol not needed by the body transported

gallbladder

64

excess cholesterol might accidentally precipitate out as

gall stones

65

what steroid hormone regulate Na+ and K+ ions and promotes water retention

aldosterone

66

what steroid hormone regulates the conversion of proteins to carbohydrates

cortisone

67

what is the emulsifier found in egg yolks

lecithin

68

what kinds of lipids are found in the cell membrane (3)

1. phospholipids
2. glycolipids
3. cholesterol

69

what are the products of saponification of a fat

glycerol
3 salts of fatty acids

70

cholesterol is used to synthesize what three types of compounds

steroid hormones

vitamin D

bile salts

71

what general structure feature do phosphatides share with soap

ionic end


hydrophilic

72

what structural feature is found in most prostaglandins

5 carbon ring

73

what functional group is found in a saponifiable lipid which is NOT found in a NONsaponifiable lipi

ester linkage

74

lack of enzyme to metabolize glycolipids may cause what diseases

Niemann- Pick

Gancher's

Tay Sachs

75

what functions doe fat serve in the body

1. energy
2. insulation
3. protection of vital organs

76

can waxes be converted into a soap

yes but difficult

77

what are the differences between a fat and an oil

oil is unsaturated fatty acid

78

why do unsaturated fatty acids have lower melting points than saturated fatty acids

cis double bonds cause "bonds" = do not stack well

79

how do the products of the acid hydrolysis and base hydrolysis of fat differ

acid hydrolysis= fatty acids

base hydrolysis=
salts of fatty acids

80

why does coconut oil (veggie) have a melting point similar to fats from animal sources

it has very few double bonds